On Target ACE_HUMAN 0.46363637/CHEMBL434617
For the given ligand Peramivir, we have found in our database that, being scored 0.46363637, the most similar ligand is CHEMBL434617. Check out the elaboration below.
| Peramivir (Given Ligand) | CHEMBL434617 (Similar Ligand) |
|---|---|
| CCC(CC)[C@H](NC(C)=O)[C@H]1[C@H](NC(=N)N)C[C@H](C(=O)O)[C@H]1O | CC(NC(C1CCCN1C(=O)NC(CCCCN)C(=O)N2C(CCC2=O)C(=O)O)C(=O)O)C(=O)N3CCCC3C(=O)O |
|
|
|
|
|
|
| 00030000 01001400 00100000 00000c00 00180000 00000000 00000000 20002000 00000200 000001a2 00200000 40011000 1400901a 01800000 00000000 00180008 00000000 00000000 01c02000 00000201 00000000 101d2e10 01000080 00100018 00000003 00000000 40000000 10000000 00000010 01040011 801a0000 00800a00 | 00030000 01007000 00100000 04000c00 00080080 00000010 00000004 20002008 00000000 00020080 00202000 40013000 0e00b03a 01802003 80180000 00080008 10000010 00000001 00c02050 00000201 00020100 30150e30 03000083 02100018 00013003 00000000 00000000 10000000 08000000 00040001 20084000 00802200 |