On Target 5HT1B_HUMAN 0.32817337/CHEMBL225310
For the given ligand Baloxavir, we have found in our database that, being scored 0.32817337, the most similar ligand is CHEMBL225310. Check out the elaboration below.
| Baloxavir (Given Ligand) | CHEMBL225310 (Similar Ligand) |
|---|---|
| COC(=O)OCOc6c5C(=O)N1CCOC[C@H]1N([C@@H]4c2ccccc2SCc3c(F)c(F)ccc34)n5ccc6=O | CCN(C1CCN(CC)C1)c2cc(OC)cc3C(=O)C=C(Nc23)C(=O)Nc4ccc(cc4)N5CCOCC5 |
|
|
|
|
|
|
| 008002be 0380ce08 671a6508 93310e00 041e11a8 00720136 184c0404 03247603 02304001 007b68c0 4b690414 708580b8 58009d06 48741008 01021478 022c610d 34025208 0200459a 00380060 001a0203 c0060501 0843ae00 72806000 4250811d 24102410 f0000081 84904860 e0040001 0b083384 04cfc013 94040001 c0c547a8 | 00004002 80201c08 20105128 94010e20 280610a0 08100030 02080000 22001001 02000000 40000be0 002d0004 4000c000 00028806 08702000 01021049 020c010c 10040080 02004000 08200000 00022601 60100000 38068608 3281a000 c2500016 00102402 81100081 08000460 90040080 08008304 04460011 80040020 40024280 |