On Target TLR4_HUMAN 0.22881356/CHEMBL4068003
For the given ligand Baloxavir, we have found in our database that, being scored 0.22881356, the most similar ligand is CHEMBL4068003. Check out the elaboration below.
| Baloxavir (Given Ligand) | CHEMBL4068003 (Similar Ligand) |
|---|---|
| COC(=O)OCOc6c5C(=O)N1CCOC[C@H]1N([C@@H]4c2ccccc2SCc3c(F)c(F)ccc34)n5ccc6=O | Cn1c2C(=O)N(C(=Nc2c3cc(ccc13)c4ccccc4)SCC(=O)NC5CCCCC5)c6ccccc6 |
|
|
|
|
|
|
| 008002be 0380ce08 671a6508 93310e00 041e11a8 00720136 184c0404 03247603 02304001 007b68c0 4b690414 708580b8 58009d06 48741008 01021478 022c610d 34025208 0200459a 00380060 001a0203 c0060501 0843ae00 72806000 4250811d 24102410 f0000081 84904860 e0040001 0b083384 04cfc013 94040001 c0c547a8 | 0000200a 01801200 201841a0 08112702 000d0040 0000c060 00008102 20001000 06560100 420248e0 0130000c 40018000 00009806 00e40080 100c00c0 000c0004 0c020008 02008204 06602020 00000213 c0000080 18048678 31900841 85780018 22000000 90000000 2000c048 10040040 24604000 00460049 400c0200 022107c0 |