On Target TLR4_HUMAN 0.31875/CHEMBL3354639
For the given ligand Peramivir, we have found in our database that, being scored 0.31875, the most similar ligand is CHEMBL3354639. Check out the elaboration below.
| Peramivir (Given Ligand) | CHEMBL3354639 (Similar Ligand) |
|---|---|
| CCC(CC)[C@H](NC(C)=O)[C@H]1[C@H](NC(=N)N)C[C@H](C(=O)O)[C@H]1O | CCCCCCCCCCCCCC(=O)O[C@H](CCCCCCCCCCC)CC(=O)O[C@@H]1[C@@H](NC(=O)C[C@@H](CCCCCCCCCCC)OC(=O)CCCCCCCCCCC)[C@@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](OC(=O)C[C@H](CCCCCCCCCCC)OC(=O)CCCCCCCCCCC)[C@H](O)[C@@H]2OC)O[C@H](CO)[C@H]1OP(=O)(O)O |
|
|
|
|
|
|
| 00030000 01001400 00100000 00000c00 00180000 00000000 00000000 20002000 00000200 000001a2 00200000 40011000 1400901a 01800000 00000000 00180008 00000000 00000000 01c02000 00000201 00000000 101d2e10 01000080 00100018 00000003 00000000 40000000 10000000 00000010 01040011 801a0000 00800a00 | 00010040 01005000 00100718 81810f00 803c00c4 00200000 00007800 28002040 00206000 010000a0 00200000 40019000 1400800a 038a0020 00081008 002b9a08 10ae0060 00000000 11c0a000 00005203 00100020 14140e10 17000180 08100018 10000401 00000000 16808200 34010021 00000202 0004001f 01e20000 0000aa00 |