On Target CNR2_HUMAN 0.43396226/CHEMBL1765285
For the given ligand Peramivir, we have found in our database that, being scored 0.43396226, the most similar ligand is CHEMBL1765285. Check out the elaboration below.
| Peramivir (Given Ligand) | CHEMBL1765285 (Similar Ligand) |
|---|---|
| CCC(CC)[C@H](NC(C)=O)[C@H]1[C@H](NC(=N)N)C[C@H](C(=O)O)[C@H]1O | CN1CC(CCC1=O)C(=O)N2CC[C@](O)([C@@H]3CCCC[C@H]23)c4ccccc4 |
|
|
|
|
|
|
| 00030000 01001400 00100000 00000c00 00180000 00000000 00000000 20002000 00000200 000001a2 00200000 40011000 1400901a 01800000 00000000 00180008 00000000 00000000 01c02000 00000201 00000000 101d2e10 01000080 00100018 00000003 00000000 40000000 10000000 00000010 01040011 801a0000 00800a00 | 00010000 01001600 00100102 00010600 00080000 00004000 00000000 20000000 00000900 000a09e0 08300000 50019000 0c008012 00a00000 00000000 000c0008 00000000 02000001 02c02010 00000201 00000100 181c0630 01000080 00500018 00001001 80000000 00000000 10000000 00000002 0006001b 40020000 00002600 |