On Target NTRK1_HUMAN 0.34042552/CHEMBL3911052
For the given ligand Baloxavir, we have found in our database that, being scored 0.34042552, the most similar ligand is CHEMBL3911052. Check out the elaboration below.
| Baloxavir (Given Ligand) | CHEMBL3911052 (Similar Ligand) |
|---|---|
| COC(=O)OCOc6c5C(=O)N1CCOC[C@H]1N([C@@H]4c2ccccc2SCc3c(F)c(F)ccc34)n5ccc6=O | COc1cccnc1CNC(=O)c2cc(NC(=O)c3cc(c(F)cc3Cl)c4ccccn4)n(n2)c5ccccc5 |
|
|
|
|
|
|
| 008002be 0380ce08 671a6508 93310e00 041e11a8 00720136 184c0404 03247603 02304001 007b68c0 4b690414 708580b8 58009d06 48741008 01021478 022c610d 34025208 0200459a 00380060 001a0203 c0060501 0843ae00 72806000 4250811d 24102410 f0000081 84904860 e0040001 0b083384 04cfc013 94040001 c0c547a8 | 1000a007 00801a0d 6018430c 12010e00 050c1021 0c104116 30880000 0228340b 00800904 501108d8 09398024 4014c810 02008c26 08301004 03230640 1a0c611c 00062200 0f803102 84600000 00720801 c0100888 18078720 31814800 8340801c 00346600 c0000200 28370040 800008c1 3400430c 00468409 cc0e8800 830247e0 |