On Target CDK5_HUMAN 0.28/CHEMBL1967878
For the given ligand Oseltamivir, we have found in our database that, being scored 0.28, the most similar ligand is CHEMBL1967878. Check out the elaboration below.
| Oseltamivir (Given Ligand) | CHEMBL1967878 (Similar Ligand) |
|---|---|
| CCOC(=O)/C1=C/[C@@H](OC(CC)CC)[C@H](NC(C)=O)[C@@H](N)C1 | CN1CCN(CC1)c2ccc(Nc3ncc(F)c(NC4C5CC(C=C5)C4C(=O)N)n3)cc2C |
|
|
|
|
|
|
| 00070040 09007000 00100000 80010700 00180080 00000800 02080180 38000402 11000000 00100088 40200000 41019001 0402801a 01880000 00001408 00081008 10a24000 00000060 60c12010 00000201 00000020 30040e80 13008000 02100018 10001400 00001400 00c04200 90000001 0c000200 00040401 04020000 00000210 | 00014002 09001001 02100320 0c090600 22000008 00106040 0008a000 00100c82 10000100 00108bd0 00200004 71019800 0c02800a 00003000 00020440 000c0004 00244400 12004060 08412010 12a00001 60180000 3c040610 2080c860 02500012 00240000 80208000 00404000 900110c0 0c408018 81460c10 64021000 400002c0 |