On Target ESR1_HUMAN 0.37804878/CHEMBL241041
For the given ligand Oseltamivir, we have found in our database that, being scored 0.37804878, the most similar ligand is CHEMBL241041. Check out the elaboration below.
| Oseltamivir (Given Ligand) | CHEMBL241041 (Similar Ligand) |
|---|---|
| CCOC(=O)/C1=C/[C@@H](OC(CC)CC)[C@H](NC(C)=O)[C@@H](N)C1 | CCCCNC(=O)CCCCCCCCCCOC[C@@H]1Cc2ccccc2CN1C(=O)c3ccc(C)cc3 |
|
|
|
|
|
|
| 00070040 09007000 00100000 80010700 00180080 00000800 02080180 38000402 11000000 00100088 40200000 41019001 0402801a 01880000 00001408 00081008 10a24000 00000060 60c12010 00000201 00000020 30040e80 13008000 02100018 10001400 00001400 00c04200 90000001 0c000200 00040401 04020000 00000210 | 00010048 01805808 00100100 d0010700 000800a0 00000000 00001000 22001004 00000980 000808c0 08300000 40019000 8400888a 00a00000 00001488 00081008 10802200 02000020 00402000 00000201 80020120 18268610 13004040 8150001c 10000400 c0000001 00804000 90000001 04000300 00860003 a0060000 00002600 |