On Target 5HT2C_HUMAN 0.3126935/CHEMBL216242
For the given ligand Baloxavir, we have found in our database that, being scored 0.3126935, the most similar ligand is CHEMBL216242. Check out the elaboration below.
| Baloxavir (Given Ligand) | CHEMBL216242 (Similar Ligand) |
|---|---|
| COC(=O)OCOc6c5C(=O)N1CCOC[C@H]1N([C@@H]4c2ccccc2SCc3c(F)c(F)ccc34)n5ccc6=O | Fc1ccc(Cc2cc3C(=O)N(CCc4ccc(CN5CCCCC5)cc4)CCn3c2)cc1 |
|
|
|
|
|
|
| 008002be 0380ce08 671a6508 93310e00 041e11a8 00720136 184c0404 03247603 02304001 007b68c0 4b690414 708580b8 58009d06 48741008 01021478 022c610d 34025208 0200459a 00380060 001a0203 c0060501 0843ae00 72806000 4250811d 24102410 f0000081 84904860 e0040001 0b083384 04cfc013 94040001 c0c547a8 | 08000002 0100bc00 00100100 52010e18 04004020 00100110 10002000 23003005 00600180 00090ad0 08290004 50018a00 80009802 08101000 00020c00 080c010c 00014000 82800086 00200400 00120201 04000001 382d8610 20802001 8350001c 08152000 e0000000 08400000 d0000001 0c040184 00068053 a0044200 00004620 |