On Target PTGES_HUMAN 0.38679245/CHEMBL3919693
For the given ligand Peramivir, we have found in our database that, being scored 0.38679245, the most similar ligand is CHEMBL3919693. Check out the elaboration below.
| Peramivir (Given Ligand) | CHEMBL3919693 (Similar Ligand) |
|---|---|
| CCC(CC)[C@H](NC(C)=O)[C@H]1[C@H](NC(=N)N)C[C@H](C(=O)O)[C@H]1O | CC1(C)CN(CC[C@H]1C(=O)N[C@H]2CCC[C@H](CO)C2)c3ccc(cc3)C(F)(F)F |
|
|
|
|
|
|
| 00030000 01001400 00100000 00000c00 00180000 00000000 00000000 20002000 00000200 000001a2 00200000 40011000 1400901a 01800000 00000000 00180008 00000000 00000000 01c02000 00000201 00000000 101d2e10 01000080 00100018 00000003 00000000 40000000 10000000 00000010 01040011 801a0000 00800a00 | 00024002 01001800 00100100 00010600 20180000 00002000 00000400 20000000 00200000 000008d0 00200004 50039000 04008002 01808000 00020040 00080008 00040000 02000000 0a402000 00000201 40100000 18040610 21000000 00500018 00000000 80000000 00000200 90000080 00008000 00060001 00120000 00802a00 |