On Target MIF_HUMAN 0.24671052/CHEMBL3797437
For the given ligand Baloxavir, we have found in our database that, being scored 0.24671052, the most similar ligand is CHEMBL3797437. Check out the elaboration below.
| Baloxavir (Given Ligand) | CHEMBL3797437 (Similar Ligand) |
|---|---|
| COC(=O)OCOc6c5C(=O)N1CCOC[C@H]1N([C@@H]4c2ccccc2SCc3c(F)c(F)ccc34)n5ccc6=O | Oc1cc2OCOc2cc1C(N3CCOCC3)c4ccc(cc4)C(F)(F)F |
|
|
|
|
|
|
| 008002be 0380ce08 671a6508 93310e00 041e11a8 00720136 184c0404 03247603 02304001 007b68c0 4b690414 708580b8 58009d06 48741008 01021478 022c610d 34025208 0200459a 00380060 001a0203 c0060501 0843ae00 72806000 4250811d 24102410 f0000081 84904860 e0040001 0b083384 04cfc013 94040001 c0c547a8 | 00000009 46000008 20100108 80010600 00001080 00000000 42040400 03001600 00200100 00180850 48200000 40008800 80004802 21000000 01001409 0028a108 10000000 02000000 00080000 00020a00 00040200 08008000 12000000 00468010 40000400 e0000000 003a0100 f0000001 01040380 00060002 06140000 02010600 |