On Target HRH1_HUMAN 0.27722773/CHEMBL1278112
For the given ligand Zanamivir, we have found in our database that, being scored 0.27722773, the most similar ligand is CHEMBL1278112. Check out the elaboration below.
| Zanamivir (Given Ligand) | CHEMBL1278112 (Similar Ligand) |
|---|---|
| CC(=O)N[C@@H]1[C@@H](/N=C(N)\N)\C=C(C(=O)O)/O[C@H]1[C@H](O)[C@H](O)CO | OC(=O)C1CN(CCO1)C2CC[C@@]3(C2)Cc4ccccc4Cc5ccccc35 |
|
|
|
|
|
|
| 00000008 89047200 00100041 90010d01 003880c1 00000200 000b0180 38800c00 01000000 011004ca 80200010 4001c000 80028002 01880008 02001408 390b9008 30200804 82000140 51c16010 00082201 00000020 30140fb0 1f008081 0a10001c 00021481 80000c00 40c14000 90100121 08804240 00048401 2c060000 00804a00 | 00000000 01000200 00100102 80010600 00000080 00000002 00000400 21000001 04100800 000808c0 08300000 4001d000 08008002 00200000 00081028 120d0108 10000000 82000000 00902010 00000201 00000100 18100a10 17404080 08500814 00001401 a0000001 00000000 50000021 02000282 0106000a 00020000 00002700 |