On Target HRH1_HUMAN 0.34104046/CHEMBL94726
For the given ligand Baloxavir, we have found in our database that, being scored 0.34104046, the most similar ligand is CHEMBL94726. Check out the elaboration below.
| Baloxavir (Given Ligand) | CHEMBL94726 (Similar Ligand) |
|---|---|
| COC(=O)OCOc6c5C(=O)N1CCOC[C@H]1N([C@@H]4c2ccccc2SCc3c(F)c(F)ccc34)n5ccc6=O | COc1ccc(C(=O)N2CCC(CCN3CCC(CC3)C(=O)c4nc5ccccc5n4Cc6ccc(F)cc6)(C2)c7ccc8OCOc8c7)c(OC)c1OC |
|
|
|
|
|
|
| 008002be 0380ce08 671a6508 93310e00 041e11a8 00720136 184c0404 03247603 02304001 007b68c0 4b690414 708580b8 58009d06 48741008 01021478 022c610d 34025208 0200459a 00380060 001a0203 c0060501 0843ae00 72806000 4250811d 24102410 f0000081 84904860 e0040001 0b083384 04cfc013 94040001 c0c547a8 | 0002000b 47801a08 20101509 12010600 000c1060 c0024110 43040000 22001504 80300980 101818c0 4938800c 50839000 0400d802 20501000 010344c1 222ca00c 00000000 06000104 00680008 00130a01 c0240300 18268630 21806041 8154841c 40000000 c0000000 00320800 b0000081 05000304 00c6880b e40c0000 20812680 |