On Target IKKB_HUMAN 0.3341289/CHEMBL3926437
For the given ligand Baloxavir, we have found in our database that, being scored 0.3341289, the most similar ligand is CHEMBL3926437. Check out the elaboration below.
| Baloxavir (Given Ligand) | CHEMBL3926437 (Similar Ligand) |
|---|---|
| COC(=O)OCOc6c5C(=O)N1CCOC[C@H]1N([C@@H]4c2ccccc2SCc3c(F)c(F)ccc34)n5ccc6=O | CN(C)CCSc1ccc(Cl)c(n1)C(=O)Nc2ccc3CCc4c(nn(c5ccc6OCOc6c5)c4c3c2)C(=O)N |
|
|
|
|
|
|
| 008002be 0380ce08 671a6508 93310e00 041e11a8 00720136 184c0404 03247603 02304001 007b68c0 4b690414 708580b8 58009d06 48741008 01021478 022c610d 34025208 0200459a 00380060 001a0203 c0060501 0843ae00 72806000 4250811d 24102410 f0000081 84904860 e0040001 0b083384 04cfc013 94040001 c0c547a8 | 0000e00e c3201a09 e00a49a8 58912e10 050e1020 cc11c006 62e42101 22001409 00220904 421948d0 59798024 6010e808 1780c81a 68348200 210208c5 0a2ca10c 04060000 87801000 8c68012a 00220401 c0740b00 1817a760 30c16800 8b48c01d 50b44810 d0180241 18264240 a00008f1 1560c384 50c6000b d80e0200 832347e2 |