On Target MK03_HUMAN 0.2890625/CHEMBL3113587
For the given ligand Peramivir, we have found in our database that, being scored 0.2890625, the most similar ligand is CHEMBL3113587. Check out the elaboration below.
| Peramivir (Given Ligand) | CHEMBL3113587 (Similar Ligand) |
|---|---|
| CCC(CC)[C@H](NC(C)=O)[C@H]1[C@H](NC(=N)N)C[C@H](C(=O)O)[C@H]1O | CCCCCCCCCC(NC(=O)CNC(=O)OCc1ccccc1)C(=O)NCCc2ccccc2 |
|
|
|
|
|
|
| 00030000 01001400 00100000 00000c00 00180000 00000000 00000000 20002000 00000200 000001a2 00200000 40011000 1400901a 01800000 00000000 00180008 00000000 00000000 01c02000 00000201 00000000 101d2e10 01000080 00100018 00000003 00000000 40000000 10000000 00000010 01040011 801a0000 00800a00 | 01010000 01403000 00100100 04010600 00000000 00014000 00000000 2000000c 00800380 000808c0 08200000 4001b000 0e00800a 00012001 00000000 021a0008 00020000 02000400 00002890 00000201 00000000 38240e30 00000003 83500018 00000000 80002002 00000000 10200020 0c000200 00060003 e0024000 00002600 |