On Target NMDZ1_HUMAN 0.2532189/CHEMBL163307
For the given ligand MB, we have found in our database that, being scored 0.2532189, the most similar ligand is CHEMBL163307. Check out the elaboration below.
| MB (Given Ligand) | CHEMBL163307 (Similar Ligand) |
|---|---|
| CN(C)c3ccc2nc1ccc(=[N+](C)C)cc1sc2c3.[Cl-] | OC(=O)c1[nH]c2cc(Cl)cc(Cl)c2c1CN3CC(=O)N(C3=O)c4ccc(Cl)cc4 |
|
|
|
|
|
|
| 0003000a 11800000 04000100 10000301 001c0060 00000000 00000080 18194008 00820200 10011843 00200a04 c0018200 00100810 01400000 0002a0c0 020c0004 10068800 02202098 0c614000 20410004 40000000 69088080 318001c0 88400000 02024002 84010008 41010000 000003c4 0018801c 00061c00 20040800 02c30400 | 1001c006 09802800 00000120 14010e10 000c1020 0000c020 04004084 0a003009 00000300 00090a48 01280004 4000a800 0600888e 0070a400 800204c0 020c000c 0006c008 02c0200c 08200040 00000001 c0120100 28078fe8 20822002 8240011e 00146000 c0000400 080c4000 80000080 08008104 00060001 e004c200 82424220 |