On Target ACES_HUMAN 0.375/CHEMBL1770555
For the given ligand MB, we have found in our database that, being scored 0.375, the most similar ligand is CHEMBL1770555. Check out the elaboration below.
| MB (Given Ligand) | CHEMBL1770555 (Similar Ligand) |
|---|---|
| CN(C)c3ccc2nc1ccc(=[N+](C)C)cc1sc2c3.[Cl-] | O=C1C=C(NCCCCCCNCc2ccc(cc2)c3nc4ccccc4s3)C(=O)C=C1NCCCCCCNCc5ccc(cc5)c6nc7ccccc7s6 |
|
|
|
|
|
|
| 0003000a 11800000 04000100 10000301 001c0060 00000000 00000080 18194008 00820200 10011843 00200a04 c0018200 00100810 01400000 0002a0c0 020c0004 10068800 02202098 0c614000 20410004 40000000 69088080 318001c0 88400000 02024002 84010008 41010000 000003c4 0018801c 00061c00 20040800 02c30400 | 00430002 19000001 00100108 10090600 000c0020 00208004 000803a0 2a19d40a 01400500 101018c9 00208a04 5101a200 82008832 00400000 800224c0 020c044c 00010000 020020c0 00232010 00400201 40000001 58008290 20808000 02510810 06800002 cc000000 40400000 90040704 0010010c 00061400 24044800 42412600 |