On Target AOFA_HUMAN 1/CHEMBL405110
For the given ligand MB, we have found in our database that, being scored 1, the most similar ligand is CHEMBL405110. Check out the elaboration below.
| MB (Given Ligand) | CHEMBL405110 (Similar Ligand) |
|---|---|
| CN(C)c3ccc2nc1ccc(=[N+](C)C)cc1sc2c3.[Cl-] | [Cl-].CN(C)c1ccc2N=C3C=CC(=[N+](C)C)C=C3Sc2c1 |
|
|
|
|
|
|
| 0003000a 11800000 04000100 10000301 001c0060 00000000 00000080 18194008 00820200 10011843 00200a04 c0018200 00100810 01400000 0002a0c0 020c0004 10068800 02202098 0c614000 20410004 40000000 69088080 318001c0 88400000 02024002 84010008 41010000 000003c4 0018801c 00061c00 20040800 02c30400 | 0003000a 11800000 04000100 10000301 001c0060 00000000 00000080 18194008 00820200 10011843 00200a04 c0018200 00100810 01400000 0002a0c0 020c0004 10068800 02202098 0c614000 20410004 40000000 69088080 318001c0 88400000 02024002 84010008 41010000 000003c4 0018801c 00061c00 20040800 02c30400 |