On Target CHLE_HUMAN 0.3069307/CHEMBL4078849
For the given ligand MB, we have found in our database that, being scored 0.3069307, the most similar ligand is CHEMBL4078849. Check out the elaboration below.
| MB (Given Ligand) | CHEMBL4078849 (Similar Ligand) |
|---|---|
| CN(C)c3ccc2nc1ccc(=[N+](C)C)cc1sc2c3.[Cl-] | O=C(NCC1CCCN(Cc2nc3ccccc3s2)C1)c4ccc5ccccc5c4 |
|
|
|
|
|
|
| 0003000a 11800000 04000100 10000301 001c0060 00000000 00000080 18194008 00820200 10011843 00200a04 c0018200 00100810 01400000 0002a0c0 020c0004 10068800 02202098 0c614000 20410004 40000000 69088080 318001c0 88400000 02024002 84010008 41010000 000003c4 0018801c 00061c00 20040800 02c30400 | 00030002 11001c00 02100108 10010e00 000c0020 00108000 00000080 2201f00b 00400000 000019e0 00210a04 50018000 000088b2 00400020 000224c0 0204050c 00001000 02000086 00200010 00000201 40001000 d80f86a8 20800000 0251001c 02100002 cc000000 40000000 90000004 00000304 00061011 a0040000 00416600 |