On Target NK1R_HUMAN 0.32388663/CHEMBL286646
For the given ligand MB, we have found in our database that, being scored 0.32388663, the most similar ligand is CHEMBL286646. Check out the elaboration below.
| MB (Given Ligand) | CHEMBL286646 (Similar Ligand) |
|---|---|
| CN(C)c3ccc2nc1ccc(=[N+](C)C)cc1sc2c3.[Cl-] | CO\N=C(/CN(C)C(=O)c1cc(C)nc(c1)c2cccs2)\C(CCN3CCC(O)(CC3)c4ccccc4)c5ccc(Cl)c(Cl)c5 |
|
|
|
|
|
|
| 0003000a 11800000 04000100 10000301 001c0060 00000000 00000080 18194008 00820200 10011843 00200a04 c0018200 00100810 01400000 0002a0c0 020c0004 10068800 02202098 0c614000 20410004 40000000 69088080 318001c0 88400000 02024002 84010008 41010000 000003c4 0018801c 00061c00 20040800 02c30400 | 0201a402 05001a00 01104101 10011e00 00040021 0c004000 140c00c0 3818504e 00908bc0 100808c1 08330204 50018a80 82008836 00008001 88022400 0a0c001c 00028008 02043008 04a10400 20600201 c0000110 590487a0 f3800880 0054001c 02006001 c6100004 48040040 90001245 1010411c 0026040b f0088800 00c32620 |