On Target AOFB_HUMAN 0.42487046/CHEMBL2418210
For the given ligand MB, we have found in our database that, being scored 0.42487046, the most similar ligand is CHEMBL2418210. Check out the elaboration below.
| MB (Given Ligand) | CHEMBL2418210 (Similar Ligand) |
|---|---|
| CN(C)c3ccc2nc1ccc(=[N+](C)C)cc1sc2c3.[Cl-] | C1CCN(CC1)c2ccc3nc(sc3n2)c4ccccc4 |
|
|
|
|
|
|
| 0003000a 11800000 04000100 10000301 001c0060 00000000 00000080 18194008 00820200 10011843 00200a04 c0018200 00100810 01400000 0002a0c0 020c0004 10068800 02202098 0c614000 20410004 40000000 69088080 318001c0 88400000 02024002 84010008 41010000 000003c4 0018801c 00061c00 20040800 02c30400 | 00034042 11802000 08104108 10010600 200c0060 0001a000 00008080 0819c018 10400000 300008c1 00200a04 50018200 08008832 01010000 00063080 020c040c 08040000 02006088 08200010 00e00205 40100000 7c088080 21a08800 10710010 02002002 8c000000 00088480 10000284 2000800c 00061c00 00001800 02410e00 |