On Target NMDE2_HUMAN 0.2857143/CHEMBL2013205
For the given ligand MB, we have found in our database that, being scored 0.2857143, the most similar ligand is CHEMBL2013205. Check out the elaboration below.
| MB (Given Ligand) | CHEMBL2013205 (Similar Ligand) |
|---|---|
| CN(C)c3ccc2nc1ccc(=[N+](C)C)cc1sc2c3.[Cl-] | Oc1ccc2[nH]c(nc2c1CNCc3cccs3)c4cccc(F)c4F |
|
|
|
|
|
|
| 0003000a 11800000 04000100 10000301 001c0060 00000000 00000080 18194008 00820200 10011843 00200a04 c0018200 00100810 01400000 0002a0c0 020c0004 10068800 02202098 0c614000 20410004 40000000 69088080 318001c0 88400000 02024002 84010008 41010000 000003c4 0018801c 00061c00 20040800 02c30400 | 10010002 0000080c 22100304 12050610 00040060 00004010 06004080 02085400 00000100 101028d0 41208204 50008080 00010816 00409020 00022440 020c200c 00023208 0200200c 00200000 40460008 41001000 680088a0 21800000 00400100 02046000 c4000000 00102040 80000005 00000304 00468c00 44048800 80e502a0 |