On Target PRGR_HUMAN 0.2970297/CHEMBL134260
For the given ligand MB, we have found in our database that, being scored 0.2970297, the most similar ligand is CHEMBL134260. Check out the elaboration below.
| MB (Given Ligand) | CHEMBL134260 (Similar Ligand) |
|---|---|
| CN(C)c3ccc2nc1ccc(=[N+](C)C)cc1sc2c3.[Cl-] | CC1CC(C)(C)Nc2ccc(cc12)c3sc(cc3C)C#N |
|
|
|
|
|
|
| 0003000a 11800000 04000100 10000301 001c0060 00000000 00000080 18194008 00820200 10011843 00200a04 c0018200 00100810 01400000 0002a0c0 020c0004 10068800 02202098 0c614000 20410004 40000000 69088080 318001c0 88400000 02024002 84010008 41010000 000003c4 0018801c 00061c00 20040800 02c30400 | 00016002 01002a01 00100902 00010e00 20100021 00022040 01040080 0c100008 00000900 808808c1 08310204 40808280 00000018 08208011 20023040 000c2408 00468000 02005008 0ca00008 10000001 40100110 58020080 31008400 00400010 02000000 85000080 00410000 100012c5 0008c018 0006000a 00000000 20c10600 |