On Target OPRD_HUMAN 0.32093024/CHEMBL200940
For the given ligand MB, we have found in our database that, being scored 0.32093024, the most similar ligand is CHEMBL200940. Check out the elaboration below.
| MB (Given Ligand) | CHEMBL200940 (Similar Ligand) |
|---|---|
| CN(C)c3ccc2nc1ccc(=[N+](C)C)cc1sc2c3.[Cl-] | C(c1ccccc1)n2ccnc2C3(CCN(CC3)c4nc5ccccc5s4)c6ccccc6 |
|
|
|
|
|
|
| 0003000a 11800000 04000100 10000301 001c0060 00000000 00000080 18194008 00820200 10011843 00200a04 c0018200 00100810 01400000 0002a0c0 020c0004 10068800 02202098 0c614000 20410004 40000000 69088080 318001c0 88400000 02024002 84010008 41010000 000003c4 0018801c 00061c00 20040800 02c30400 | 0003000a 11800600 00101508 10010600 000c0040 00088000 00000120 30329018 80400900 300818c2 08308a0c 50018400 00001822 00400000 000324c0 001c048c 00000000 06004081 00680018 00a10201 e0000100 5c008080 61800840 83710410 00000000 cc000000 40000000 10000504 0400001c 00ce280a 600c1000 24410600 |