On Target P2RX3_HUMAN 0.45714286/CHEMBL3958199
For the given ligand diclofenac, we have found in our database that, being scored 0.45714286, the most similar ligand is CHEMBL3958199. Check out the elaboration below.
| diclofenac (Given Ligand) | CHEMBL3958199 (Similar Ligand) |
|---|---|
| O=C(O)Cc1ccccc1Nc2c(Cl)cccc2Cl | CCNc1ccc(Nc2ccc(OC(C)C)cc2)c(Cc3ccc(Cl)cc3)c1 |
|
|
|
|
|
|
| 00008002 00000000 00000100 00010200 00000040 00000020 00000010 08000040 00002000 00080841 08210004 40009800 03008004 00000400 40060040 00080008 08048000 02000000 08000002 00000000 40000400 48000b00 21000000 00400010 00002000 80000600 02000008 00001080 00008008 00261002 00002000 20020400 | 0c00c002 00001008 60000108 00010600 00001020 00080000 02000010 01000048 00402000 00080850 08200004 40008800 02800026 00000000 01020041 00080008 00048000 02000001 08000002 00020000 44100000 08040100 20000000 00400010 00042000 a0000000 02040008 40001080 00408280 00260002 00000000 20020600 |