On Target TRPV1_RAT 0.5697674/CHEMBL237138
For the given ligand Oxetacaine, we have found in our database that, being scored 0.5697674, the most similar ligand is CHEMBL237138. Check out the elaboration below.
| Oxetacaine (Given Ligand) | CHEMBL237138 (Similar Ligand) |
|---|---|
| CN(C(=O)CN(CCO)CC(=O)N(C)C(C)(C)Cc1ccccc1)C(C)(C)Cc2ccccc2 | NCCCCCCN(CCc1ccc(Cl)cc1Cl)CC(=O)N(CCc2ccc(Cl)cc2Cl)CC(=O)N |
|
|
|
|
|
|
| 00000000 00001000 00100100 04010600 00000080 00000000 00000000 00000004 00000880 00080840 08302000 4000a000 02008002 00002003 00100000 00080008 10000000 02000000 00000000 00000201 00000100 38200600 02000003 83400018 00000000 80000000 00000000 00000000 0c000000 00060003 00004000 00000600 | 00008000 01003000 00110100 04010600 00000000 00000020 00000000 20000004 00000080 000808c0 08200000 4001a900 02008026 00002401 80000000 00000000 00000000 02000000 00002000 00000201 00000400 38200710 00000003 83500018 00002000 80000200 00040000 10000000 0c000000 00060003 20004000 00022600 |