On Target PAR1_HUMAN 0.5591398/CHEMBL337875
For the given ligand Oxetacaine, we have found in our database that, being scored 0.5591398, the most similar ligand is CHEMBL337875. Check out the elaboration below.
| Oxetacaine (Given Ligand) | CHEMBL337875 (Similar Ligand) |
|---|---|
| CN(C(=O)CN(CCO)CC(=O)N(C)C(C)(C)Cc1ccccc1)C(C)(C)Cc2ccccc2 | CC(C)C[C@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](C)N)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N |
|
|
|
|
|
|
| 00000000 00001000 00100100 04010600 00000080 00000000 00000000 00000004 00000880 00080840 08302000 4000a000 02008002 00002003 00100000 00080008 10000000 02000000 00000000 00000201 00000100 38200600 02000003 83400018 00000000 80000000 00000000 00000000 0c000000 00060003 00004000 00000600 | 00010000 01003200 00100100 04010e00 00000002 00000000 00010000 2000000c 00200880 000808c2 08300010 4003b000 06008012 00002009 80000000 00040000 00000800 02000000 00000008 00000201 00000100 38240620 00000003 83500018 00000800 80000000 40010000 10000000 0c000000 0006000b 20004000 00002600 |