On Target AMPN_HUMAN 0.58947366/CHEMBL1941150
For the given ligand Oxetacaine, we have found in our database that, being scored 0.58947366, the most similar ligand is CHEMBL1941150. Check out the elaboration below.
| Oxetacaine (Given Ligand) | CHEMBL1941150 (Similar Ligand) |
|---|---|
| CN(C(=O)CN(CCO)CC(=O)N(C)C(C)(C)Cc1ccccc1)C(C)(C)Cc2ccccc2 | CC(C)C[C@H](NC(=O)[C@@H](O)[C@H](N)Cc1ccccc1)C(=O)N2CCC[C@H]2C(=O)N3CCC[C@H]3C(=O)O |
|
|
|
|
|
|
| 00000000 00001000 00100100 04010600 00000080 00000000 00000000 00000004 00000880 00080840 08302000 4000a000 02008002 00002003 00100000 00080008 10000000 02000000 00000000 00000201 00000100 38200600 02000003 83400018 00000000 80000000 00000000 00000000 0c000000 00060003 00004000 00000600 | 00010000 01007400 00100102 04010600 00080080 00000010 00000000 20000008 00100800 000809c0 08300000 4001f000 0e008012 01202003 80180000 00080008 10000000 02000000 00400000 00000201 00000100 38040e20 03000043 83500018 00000000 80000000 00000000 10000000 0c000000 00060013 20004000 00402600 |