On Target AOFA_HUMAN 0.46478873/CHEMBL3330339
For the given ligand Oxetacaine, we have found in our database that, being scored 0.46478873, the most similar ligand is CHEMBL3330339. Check out the elaboration below.
| Oxetacaine (Given Ligand) | CHEMBL3330339 (Similar Ligand) |
|---|---|
| CN(C(=O)CN(CCO)CC(=O)N(C)C(C)(C)Cc1ccccc1)C(C)(C)Cc2ccccc2 | C[C@]1(N)C[C@@H]1c2ccccc2.OC(=O)C(F)(F)F |
|
|
|
|
|
|
| 00000000 00001000 00100100 04010600 00000080 00000000 00000000 00000004 00000880 00080840 08302000 4000a000 02008002 00002003 00100000 00080008 10000000 02000000 00000000 00000201 00000100 38200600 02000003 83400018 00000000 80000000 00000000 00000000 0c000000 00060003 00004000 00000600 | 00000000 01000200 00100102 00010600 00000000 00000000 00000000 00000000 00000800 000808c0 08100000 40008000 00008000 01200000 00000000 00080008 00000000 02000000 00000000 00000005 00000100 18000a00 00000000 81400010 00000000 80000000 00000000 90000000 04000000 0006000a 00000000 00000600 |