On Target ADRB2_HUMAN 0.5064935/CHEMBL388177
For the given ligand Oxetacaine, we have found in our database that, being scored 0.5064935, the most similar ligand is CHEMBL388177. Check out the elaboration below.
| Oxetacaine (Given Ligand) | CHEMBL388177 (Similar Ligand) |
|---|---|
| CN(C(=O)CN(CCO)CC(=O)N(C)C(C)(C)Cc1ccccc1)C(C)(C)Cc2ccccc2 | C[C@H](Cc1cccc2ccccc12)NC[C@@H](O)c3cc(O)cc(O)c3 |
|
|
|
|
|
|
| 00000000 00001000 00100100 04010600 00000080 00000000 00000000 00000004 00000880 00080840 08302000 4000a000 02008002 00002003 00100000 00080008 10000000 02000000 00000000 00000201 00000100 38200600 02000003 83400018 00000000 80000000 00000000 00000000 0c000000 00060003 00004000 00000600 | 00000001 4a000008 20100100 00010600 00000080 80004000 02000000 00000000 00000980 00080840 08300000 40008000 00000002 00000000 00080000 00080008 10000000 02000000 00000000 00020a01 00000100 18200028 02000000 81400010 00000000 80000000 00000000 00000000 04000000 00060002 40000000 00002600 |