On Target CASP1_HUMAN 0.6136364/CHEMBL311315
For the given ligand Oxetacaine, we have found in our database that, being scored 0.6136364, the most similar ligand is CHEMBL311315. Check out the elaboration below.
| Oxetacaine (Given Ligand) | CHEMBL311315 (Similar Ligand) |
|---|---|
| CN(C(=O)CN(CCO)CC(=O)N(C)C(C)(C)Cc1ccccc1)C(C)(C)Cc2ccccc2 | CC(C)[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)C)C(=O)N[C@@H](C)C(=O)N[C@@H](CC(=O)O)C=O |
|
|
|
|
|
|
| 00000000 00001000 00100100 04010600 00000080 00000000 00000000 00000004 00000880 00080840 08302000 4000a000 02008002 00002003 00100000 00080008 10000000 02000000 00000000 00000201 00000100 38200600 02000003 83400018 00000000 80000000 00000000 00000000 0c000000 00060003 00004000 00000600 | 00040000 00003200 00100100 04010600 00000000 00000000 00000000 2000000c 00000880 000808c0 08300000 4000b000 0e008002 00002001 80000000 000c0008 00000000 02000001 00c00018 00000201 00000100 38300e00 01000083 83400018 00001801 80000000 00000000 10000000 0c000002 0006000b 20004000 00002600 |