On Target CHLE_HUMAN 0.46/CHEMBL4089230
For the given ligand Oxetacaine, we have found in our database that, being scored 0.46, the most similar ligand is CHEMBL4089230. Check out the elaboration below.
| Oxetacaine (Given Ligand) | CHEMBL4089230 (Similar Ligand) |
|---|---|
| CN(C(=O)CN(CCO)CC(=O)N(C)C(C)(C)Cc1ccccc1)C(C)(C)Cc2ccccc2 | CN(C)CCN(CC1CCCN(C1)C2Cc3ccccc3C2)C(=O)c4ccc5ccccc5c4 |
|
|
|
|
|
|
| 00000000 00001000 00100100 04010600 00000080 00000000 00000000 00000004 00000880 00080840 08302000 4000a000 02008002 00002003 00100000 00080008 10000000 02000000 00000000 00000201 00000100 38200600 02000003 83400018 00000000 80000000 00000000 00000000 0c000000 00060003 00004000 00000600 | 00000000 01003c00 00100102 04010600 00000020 00000000 00000000 22001008 00000880 000909e0 08300000 50018000 00008802 00203000 00000400 00020000 00000200 02000000 00000000 00000201 00000100 382e8628 00004001 8350001c 00000000 c0000000 00000000 90000000 0c000100 00060013 a0040000 00002600 |