On Target PDE4B_HUMAN 0.4716981/CHEMBL286391
For the given ligand Oxetacaine, we have found in our database that, being scored 0.4716981, the most similar ligand is CHEMBL286391. Check out the elaboration below.
| Oxetacaine (Given Ligand) | CHEMBL286391 (Similar Ligand) |
|---|---|
| CN(C(=O)CN(CCO)CC(=O)N(C)C(C)(C)Cc1ccccc1)C(C)(C)Cc2ccccc2 | COc1ccc(cc1OC2CCCC2)C3CCN(C3)C(=O)C(=O)N |
|
|
|
|
|
|
| 00000000 00001000 00100100 04010600 00000080 00000000 00000000 00000004 00000880 00080840 08302000 4000a000 02008002 00002003 00100000 00080008 10000000 02000000 00000000 00000201 00000100 38200600 02000003 83400018 00000000 80000000 00000000 00000000 0c000000 00060003 00004000 00000600 | 04000000 43001208 20100108 00210700 00081000 c2000010 02040000 20000004 04000880 000808c0 08300000 4000a000 0280c002 20000080 91000001 020ca008 00800000 02000000 00480000 00020201 00000100 38240600 01000001 83400018 00000000 80000000 00120000 10000000 0c000200 0106000b 00004000 00000640 |