On Target ACM4_HUMAN 0.53535354/CHEMBL211976
For the given ligand Oxetacaine, we have found in our database that, being scored 0.53535354, the most similar ligand is CHEMBL211976. Check out the elaboration below.
| Oxetacaine (Given Ligand) | CHEMBL211976 (Similar Ligand) |
|---|---|
| CN(C(=O)CN(CCO)CC(=O)N(C)C(C)(C)Cc1ccccc1)C(C)(C)Cc2ccccc2 | O[C@@H]1C[C@H](N(C1)C(=O)CC(c2ccccc2)(c3ccccc3)c4ccccc4)C(=O)N5CCC[C@@H]5C(=O)NCCC6CCNCC6 |
|
|
|
|
|
|
| 00000000 00001000 00100100 04010600 00000080 00000000 00000000 00000004 00000880 00080840 08302000 4000a000 02008002 00002003 00100000 00080008 10000000 02000000 00000000 00000201 00000100 38200600 02000003 83400018 00000000 80000000 00000000 00000000 0c000000 00060003 00004000 00000600 | 00050000 01007200 00100100 04010600 00100080 00000010 00000000 21000008 00000800 000808c0 08300000 5001b000 06008012 00002003 80180000 000c0008 10000000 02000000 00c00008 00000201 00000100 38140620 03000083 02500018 00000801 a0000000 00000000 50000000 08000080 0006000b 20004000 00002e00 |