On Target TNFA_HUMAN 0.51/CHEMBL76297
For the given ligand Oxetacaine, we have found in our database that, being scored 0.51, the most similar ligand is CHEMBL76297. Check out the elaboration below.
| Oxetacaine (Given Ligand) | CHEMBL76297 (Similar Ligand) |
|---|---|
| CN(C(=O)CN(CCO)CC(=O)N(C)C(C)(C)Cc1ccccc1)C(C)(C)Cc2ccccc2 | CNC(=O)[C@@H](NC(=O)[C@@H]([C@H](CO)C(=O)NO)c1ccccc1)C(C)(C)C |
|
|
|
|
|
|
| 00000000 00001000 00100100 04010600 00000080 00000000 00000000 00000004 00000880 00080840 08302000 4000a000 02008002 00002003 00100000 00080008 10000000 02000000 00000000 00000201 00000100 38200600 02000003 83400018 00000000 80000000 00000000 00000000 0c000000 00060003 00004000 00000600 | 00060000 00003210 40100100 04010600 00100000 00000000 08000000 20000008 00200880 000808c0 08300000 4002b000 17008016 00002000 c0000000 00080018 00000000 02000000 00c00008 00040201 00000100 38200600 01000041 83400018 00002800 80000000 00000000 10000000 0c000002 0006000f 20006000 02802e00 |