On Target BACE1_HUMAN 0.5841584/CHEMBL2181018
For the given ligand Oxetacaine, we have found in our database that, being scored 0.5841584, the most similar ligand is CHEMBL2181018. Check out the elaboration below.
| Oxetacaine (Given Ligand) | CHEMBL2181018 (Similar Ligand) |
|---|---|
| CN(C(=O)CN(CCO)CC(=O)N(C)C(C)(C)Cc1ccccc1)C(C)(C)Cc2ccccc2 | CC(C)C[C@H](NC(=O)C[C@H](O)[C@H](Cc1ccccc1)NC(=O)[C@H](CCC(=O)N)N(C)C(=O)[C@@H](NC(=O)[C@H](C)O)C(C)C)C(=O)N[C@@H](C)C(=O)N(C)[C@H](Cc2ccccc2)C(=O)O |
|
|
|
|
|
|
| 00000000 00001000 00100100 04010600 00000080 00000000 00000000 00000004 00000880 00080840 08302000 4000a000 02008002 00002003 00100000 00080008 10000000 02000000 00000000 00000201 00000100 38200600 02000003 83400018 00000000 80000000 00000000 00000000 0c000000 00060003 00004000 00000600 | 00030000 01007000 00100102 04010600 00000080 00000000 00000000 2000000c 00200880 000a08c0 08300000 4003f000 1600801a 00202003 80180000 00080008 10000000 02000000 00c02008 00000201 00000100 38240e30 030000c3 83500018 00000801 80000000 00000000 10000000 0c000002 00060003 20004000 00802600 |