On Target DRD2_HUMAN 0.5/CHEMBL107742
For the given ligand Oxetacaine, we have found in our database that, being scored 0.5, the most similar ligand is CHEMBL107742. Check out the elaboration below.
| Oxetacaine (Given Ligand) | CHEMBL107742 (Similar Ligand) |
|---|---|
| CN(C(=O)CN(CCO)CC(=O)N(C)C(C)(C)Cc1ccccc1)C(C)(C)Cc2ccccc2 | CC1Cc2ccccc2N1C(=O)CN3CCN(Cc4ccc(C)cc4)CC3 |
|
|
|
|
|
|
| 00000000 00001000 00100100 04010600 00000080 00000000 00000000 00000004 00000880 00080840 08302000 4000a000 02008002 00002003 00100000 00080008 10000000 02000000 00000000 00000201 00000100 38200600 02000003 83400018 00000000 80000000 00000000 00000000 0c000000 00060003 00004000 00000600 | 00004002 00001000 00100120 04010600 20000000 00000040 00000000 02001004 00000980 00090a40 08380024 4000a000 82008802 00102001 00020540 00000000 00248000 02000000 08000008 00000201 40100100 38208600 20002023 8340001b 00000000 c0000000 00000010 80001080 0c088100 00060003 00044080 20000600 |