On Target NEP_HUMAN 0.69411767/CHEMBL92632
For the given ligand Oxetacaine, we have found in our database that, being scored 0.69411767, the most similar ligand is CHEMBL92632. Check out the elaboration below.
| Oxetacaine (Given Ligand) | CHEMBL92632 (Similar Ligand) |
|---|---|
| CN(C(=O)CN(CCO)CC(=O)N(C)C(C)(C)Cc1ccccc1)C(C)(C)Cc2ccccc2 | CC(C)[C@H](N[C@@H](C)C(=O)O)C(=O)N[C@@H](Cc1ccc(cc1)c2ccccc2)C(=O)O |
|
|
|
|
|
|
| 00000000 00001000 00100100 04010600 00000080 00000000 00000000 00000004 00000880 00080840 08302000 4000a000 02008002 00002003 00100000 00080008 10000000 02000000 00000000 00000201 00000100 38200600 02000003 83400018 00000000 80000000 00000000 00000000 0c000000 00060003 00004000 00000600 | 00002000 00005000 00100100 04010600 00000080 00000000 00000000 20000004 00000980 000808c0 08302000 4000b800 06008002 00002003 80180000 00080008 10020000 02000000 04400008 10000201 00000100 38200e00 13000041 83400018 00000800 80000000 00000000 10000040 0c004000 00060003 20004000 00002600 |