On Target NOS1_HUMAN 0.43809524/CHEMBL87186
For the given ligand Oxetacaine, we have found in our database that, being scored 0.43809524, the most similar ligand is CHEMBL87186. Check out the elaboration below.
| Oxetacaine (Given Ligand) | CHEMBL87186 (Similar Ligand) |
|---|---|
| CN(C(=O)CN(CCO)CC(=O)N(C)C(C)(C)Cc1ccccc1)C(C)(C)Cc2ccccc2 | CC(C)NC(=O)CN1CCN(CCc2ccc(cc2)c3cccc(N)n3)CC1 |
|
|
|
|
|
|
| 00000000 00001000 00100100 04010600 00000080 00000000 00000000 00000004 00000880 00080840 08302000 4000a000 02008002 00002003 00100000 00080008 10000000 02000000 00000000 00000201 00000100 38200600 02000003 83400018 00000000 80000000 00000000 00000000 0c000000 00060003 00004000 00000600 | 00002002 00000000 80104100 14010600 01040020 00000000 00000000 00080000 00000180 10080840 08208004 4000a800 02008802 00002001 00020000 02040004 00020000 02002000 04200000 10600200 40000000 3c208600 30800823 83600018 00000000 80000000 000000c0 00000060 0c40400c 00060403 00004800 00000600 |