On Target DRD3_HUMAN 0.53333336/CHEMBL1765635
For the given ligand Oxetacaine, we have found in our database that, being scored 0.53333336, the most similar ligand is CHEMBL1765635. Check out the elaboration below.
| Oxetacaine (Given Ligand) | CHEMBL1765635 (Similar Ligand) |
|---|---|
| CN(C(=O)CN(CCO)CC(=O)N(C)C(C)(C)Cc1ccccc1)C(C)(C)Cc2ccccc2 | CCCN(CCCCNC(=O)C)C1Cc2ccccc2C1 |
|
|
|
|
|
|
| 00000000 00001000 00100100 04010600 00000080 00000000 00000000 00000004 00000880 00080840 08302000 4000a000 02008002 00002003 00100000 00080008 10000000 02000000 00000000 00000201 00000100 38200600 02000003 83400018 00000000 80000000 00000000 00000000 0c000000 00060003 00004000 00000600 | 00000000 01001000 00100102 00010600 00000020 00000000 00000000 20000000 00200880 000808c0 08300000 40028000 00008002 00201000 00000000 00020000 00000200 02000000 00000000 00000201 00000100 18240600 00004000 81400018 00000000 80000000 00000000 10000000 04000000 00060003 00000000 00002600 |