On Target 5HT2A_HUMAN 0.47115386/CHEMBL2397889
For the given ligand Oxetacaine, we have found in our database that, being scored 0.47115386, the most similar ligand is CHEMBL2397889. Check out the elaboration below.
| Oxetacaine (Given Ligand) | CHEMBL2397889 (Similar Ligand) |
|---|---|
| CN(C(=O)CN(CCO)CC(=O)N(C)C(C)(C)Cc1ccccc1)C(C)(C)Cc2ccccc2 | Cc1cccc2C[C@@H]3CNCCN3C(=O)c12 |
|
|
|
|
|
|
| 00000000 00001000 00100100 04010600 00000080 00000000 00000000 00000004 00000880 00080840 08302000 4000a000 02008002 00002003 00100000 00080008 10000000 02000000 00000000 00000201 00000100 38200600 02000003 83400018 00000000 80000000 00000000 00000000 0c000000 00060003 00004000 00000600 | 00000008 00003a00 00100100 14010600 00001021 00008000 00000000 2200100c 00000880 000908c0 08300000 40008000 00008882 00202000 00000400 020c0008 00000200 02000020 00000000 00000201 00c20100 38228640 01004021 8340001c 00000000 c0000001 00004000 90000000 0c000100 0086000b a0040000 00000600 |