On Target NOS2_HUMAN 0.37179488/CHEMBL450583
For the given ligand Oxetacaine, we have found in our database that, being scored 0.37179488, the most similar ligand is CHEMBL450583. Check out the elaboration below.
| Oxetacaine (Given Ligand) | CHEMBL450583 (Similar Ligand) |
|---|---|
| CN(C(=O)CN(CCO)CC(=O)N(C)C(C)(C)Cc1ccccc1)C(C)(C)Cc2ccccc2 | Br.CCC(NC(=N)C)c1ccccc1 |
|
|
|
|
|
|
| 00000000 00001000 00100100 04010600 00000080 00000000 00000000 00000004 00000880 00080840 08302000 4000a000 02008002 00002003 00100000 00080008 10000000 02000000 00000000 00000201 00000100 38200600 02000003 83400018 00000000 80000000 00000000 00000000 0c000000 00060003 00004000 00000600 | 00000000 00000000 00100100 00010600 00000000 00000000 00000000 02001000 00000a00 00080853 08300000 40008000 00000802 00000000 00000400 00100000 00000000 02000000 00000000 00000201 00000100 18008000 00000000 00400010 00000000 c0000000 40000000 90000000 00000110 00060002 00040008 00000600 |