On Target CXCR1_HUMAN 0.3882353/CHEMBL191413
For the given ligand Oxetacaine, we have found in our database that, being scored 0.3882353, the most similar ligand is CHEMBL191413. Check out the elaboration below.
| Oxetacaine (Given Ligand) | CHEMBL191413 (Similar Ligand) |
|---|---|
| CN(C(=O)CN(CCO)CC(=O)N(C)C(C)(C)Cc1ccccc1)C(C)(C)Cc2ccccc2 | CC(C)Cc1ccc(cc1)[C@@H](C)C(=O)NS(=O)(=O)C |
|
|
|
|
|
|
| 00000000 00001000 00100100 04010600 00000080 00000000 00000000 00000004 00000880 00080840 08302000 4000a000 02008002 00002003 00100000 00080008 10000000 02000000 00000000 00000201 00000100 38200600 02000003 83400018 00000000 80000000 00000000 00000000 0c000000 00060003 00004000 00000600 | 00000040 20000000 00000100 01310600 00000000 00000000 00010000 00001000 00000900 00480840 08102000 40009800 01008001 00000001 c0000000 00000000 02000000 02000000 00000000 00004001 00000100 18000600 00000000 91400010 02000000 80000000 00000000 0000000c 04000000 00060002 00002000 00010660 |