On Target DRD4_HUMAN 0.52/CHEMBL323022
For the given ligand Oxetacaine, we have found in our database that, being scored 0.52, the most similar ligand is CHEMBL323022. Check out the elaboration below.
| Oxetacaine (Given Ligand) | CHEMBL323022 (Similar Ligand) |
|---|---|
| CN(C(=O)CN(CCO)CC(=O)N(C)C(C)(C)Cc1ccccc1)C(C)(C)Cc2ccccc2 | CC1Cc2ccccc2N1C(=O)CN3CCN(CCc4ccc(Cl)cc4)CC3 |
|
|
|
|
|
|
| 00000000 00001000 00100100 04010600 00000080 00000000 00000000 00000004 00000880 00080840 08302000 4000a000 02008002 00002003 00100000 00080008 10000000 02000000 00000000 00000201 00000100 38200600 02000003 83400018 00000000 80000000 00000000 00000000 0c000000 00060003 00004000 00000600 | 0000c002 00001000 00100120 04010600 20000000 00000040 00000000 00000004 00000880 00080a40 08380024 4000a800 02008026 00102001 00020140 00000000 00248000 02000000 08000008 00000201 40100100 38200700 20002023 8340001b 00002000 80000000 00040010 00001080 0c088000 00060003 00004080 20020600 |