On Target FYN_HUMAN 0.43617022/CHEMBL588119
For the given ligand Oxetacaine, we have found in our database that, being scored 0.43617022, the most similar ligand is CHEMBL588119. Check out the elaboration below.
| Oxetacaine (Given Ligand) | CHEMBL588119 (Similar Ligand) |
|---|---|
| CN(C(=O)CN(CCO)CC(=O)N(C)C(C)(C)Cc1ccccc1)C(C)(C)Cc2ccccc2 | CCCCCCCCN[C@H](C)[C@@H](O)c1ccc(SC(C)C)cc1 |
|
|
|
|
|
|
| 00000000 00001000 00100100 04010600 00000080 00000000 00000000 00000004 00000880 00080840 08302000 4000a000 02008002 00002003 00100000 00080008 10000000 02000000 00000000 00000201 00000100 38200600 02000003 83400018 00000000 80000000 00000000 00000000 0c000000 00060003 00004000 00000600 | 00000000 01801200 00120100 00110600 00000080 00004000 00000000 20000000 00000980 000848c0 08700000 60018000 00000002 00050000 00080000 00080008 14000000 02000000 00002000 00000201 80000100 18340030 03800000 81500019 00000000 80000000 00000000 10000000 04000000 00060002 50020000 00012620 |