On Target CAH2_HUMAN 0.7/CHEMBL286862
For the given ligand Oxetacaine, we have found in our database that, being scored 0.7, the most similar ligand is CHEMBL286862. Check out the elaboration below.
| Oxetacaine (Given Ligand) | CHEMBL286862 (Similar Ligand) |
|---|---|
| CN(C(=O)CN(CCO)CC(=O)N(C)C(C)(C)Cc1ccccc1)C(C)(C)Cc2ccccc2 | NS(=O)(=O)c1ccc(CCNC(=O)CN(CCN(CCN(CC(=O)O)CC(=O)NCCc2ccc(cc2)S(=O)(=O)N)CC(=O)O)CC(=O)O)cc1 |
|
|
|
|
|
|
| 00000000 00001000 00100100 04010600 00000080 00000000 00000000 00000004 00000880 00080840 08302000 4000a000 02008002 00002003 00100000 00080008 10000000 02000000 00000000 00000201 00000100 38200600 02000003 83400018 00000000 80000000 00000000 00000000 0c000000 00060003 00004000 00000600 | 00000010 00801000 01100100 04b10600 00000088 00000000 00000000 00000004 00000080 00080840 08202000 6000a000 02008002 00002003 80300000 00080008 10000000 02000000 00000000 00002200 80000000 38240e00 02000003 8b400018 00000000 80000000 00000000 00000028 0c000000 20060003 00004000 00010620 |