On Target ESR1_HUMAN 0.41509435/CHEMBL347560
For the given ligand Oxetacaine, we have found in our database that, being scored 0.41509435, the most similar ligand is CHEMBL347560. Check out the elaboration below.
| Oxetacaine (Given Ligand) | CHEMBL347560 (Similar Ligand) |
|---|---|
| CN(C(=O)CN(CCO)CC(=O)N(C)C(C)(C)Cc1ccccc1)C(C)(C)Cc2ccccc2 | CN(CCCc1ccc(Cl)cc1)c2nc(NCCc3ccc(O)cc3)nc(n2)N4CCN(CCO)CC4 |
|
|
|
|
|
|
| 00000000 00001000 00100100 04010600 00000080 00000000 00000000 00000004 00000880 00080840 08302000 4000a000 02008002 00002003 00100000 00080008 10000000 02000000 00000000 00000201 00000100 38200600 02000003 83400018 00000000 80000000 00000000 00000000 0c000000 00060003 00004000 00000600 | 00018000 00000209 20100100 04010600 02000080 00000000 02000000 00100880 00000900 000808c0 08300000 40009800 06000026 00002000 00100000 101c000c 10001000 02004000 00000000 00220001 00000100 3a200100 62004020 83400014 00002000 80000000 00160000 10000040 0c000018 0046000a 80001000 00020600 |