On Target PTGES_HUMAN 0.30327868/CHEMBL4071976
For the given ligand Oxetacaine, we have found in our database that, being scored 0.30327868, the most similar ligand is CHEMBL4071976. Check out the elaboration below.
| Oxetacaine (Given Ligand) | CHEMBL4071976 (Similar Ligand) |
|---|---|
| CN(C(=O)CN(CCO)CC(=O)N(C)C(C)(C)Cc1ccccc1)C(C)(C)Cc2ccccc2 | OC(=O)c1ccccc1CC[C@@H]2CCC[C@@H]2NC(=O)C3CCN(CC3)c4ccc(cc4)C(F)(F)F |
|
|
|
|
|
|
| 00000000 00001000 00100100 04010600 00000080 00000000 00000000 00000004 00000880 00080840 08302000 4000a000 02008002 00002003 00100000 00080008 10000000 02000000 00000000 00000201 00000100 38200600 02000003 83400018 00000000 80000000 00000000 00000000 0c000000 00060003 00004000 00000600 | 00024002 01001800 00100102 00010600 20000000 0000e000 00000400 20000000 00300900 000808d0 08300004 50039800 04008002 01208000 00020060 00080008 00040000 02000000 08002000 00000201 40500500 18060e70 20004000 0050001c 00000000 80000201 00000200 90000080 00008002 01060003 c0120000 00802600 |