On Target HRH1_HUMAN 0.4563107/CHEMBL305338
For the given ligand Oxetacaine, we have found in our database that, being scored 0.4563107, the most similar ligand is CHEMBL305338. Check out the elaboration below.
| Oxetacaine (Given Ligand) | CHEMBL305338 (Similar Ligand) |
|---|---|
| CN(C(=O)CN(CCO)CC(=O)N(C)C(C)(C)Cc1ccccc1)C(C)(C)Cc2ccccc2 | CCCCCC(=O)c1ccc(OCCCN2CCN(CC2)C(=O)Cc3ccccc3)cc1 |
|
|
|
|
|
|
| 00000000 00001000 00100100 04010600 00000080 00000000 00000000 00000004 00000880 00080840 08302000 4000a000 02008002 00002003 00100000 00080008 10000000 02000000 00000000 00000201 00000100 38200600 02000003 83400018 00000000 80000000 00000000 00000000 0c000000 00060003 00004000 00000600 | 04010000 01002808 2010010b 04010600 00001000 02000000 02040000 00000008 00000880 00080840 08300000 40009000 0580800a 00202000 41000001 00082008 00200000 02000000 00802000 00020201 00000100 38220600 010000a1 8340001c 00000001 80000000 00120000 00000000 0c000202 00060003 80022000 00000640 |