On Target PERM_HUMAN 0.45081967/CHEMBL1409565
For the given ligand NB001, we have found in our database that, being scored 0.45081967, the most similar ligand is CHEMBL1409565. Check out the elaboration below.
| NB001 (Given Ligand) | CHEMBL1409565 (Similar Ligand) |
|---|---|
| Nc1ncnc2c1ncn2CCNCCCCCO | O=C1N(CCN2CCCCC2)C(=S)Nc3ccccc13 |
|
|
|
|
|
|
| 0000000a 01801c00 00180000 48080620 00180040 0000c000 00008000 20000800 00600100 00000080 0020900c 40011000 00001002 01800000 00080880 100c000c 00000000 00000000 00400000 80200201 80000000 30000040 21800041 02100014 08000000 00000000 00000000 10000000 08000008 00460010 c0080000 00000ac0 | 00040002 01000400 00100000 40000600 001c0000 00004020 02000000 20000800 06200101 400c08e0 0120100c 50018000 00009002 00e00000 000008c0 000c0004 40000000 01008100 00600020 01010201 c0000000 38000038 21800041 02300010 0c000000 80000000 20000000 10040000 08004000 00470010 40080000 00010a88 |